About 2-tert-butyl-5-methoxypyridine;pyrrolidine
2-tert-butyl-5-methoxypyridine;pyrrolidine (PubChem CID 145197740) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-tert-butyl-5-methoxypyridine;pyrrolidine.
Molecular Properties
| Compound Name | 2-tert-butyl-5-methoxypyridine;pyrrolidine |
| PubChem CID | 145197740 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 2-tert-butyl-5-methoxypyridine;pyrrolidine |
| SMILES | C1CCNC1.COc1ccc(C(C)(C)C)nc1 |
| InChI | InChI=1S/C10H15NO.C4H9N/c1-10(2,3)9-6-5-8(12-4)7-11-9;1-2-4-5-3-1/h5-7H,1-4H3;5H,1-4H2 |
| InChIKey | XYOFRTAXNYFLRN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-5-methoxypyridine;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-methoxypyridine;pyrrolidine?
The IUPAC name of 2-tert-butyl-5-methoxypyridine;pyrrolidine (CID 145197740) is 2-tert-butyl-5-methoxypyridine;pyrrolidine.
What is the SMILES notation for 2-tert-butyl-5-methoxypyridine;pyrrolidine?
The canonical SMILES for 2-tert-butyl-5-methoxypyridine;pyrrolidine is C1CCNC1.COc1ccc(C(C)(C)C)nc1.
What is the InChIKey of 2-tert-butyl-5-methoxypyridine;pyrrolidine?
The InChIKey is XYOFRTAXNYFLRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO.C4H9N/c1-10(2,3)9-6-5-8(12-4)7-11-9;1-2-4-5-3-1/h5-7H,1-4H3;5H,1-4H2.
What are the key properties of 2-tert-butyl-5-methoxypyridine;pyrrolidine?
2-tert-butyl-5-methoxypyridine;pyrrolidine has a molecular weight of 236.36 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-methoxypyridine;pyrrolidine is sourced from PubChem (CID 145197740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).