C17H32N4O — CID 145197878
8-[(1E,3Z)-1,4-diamino-5-methylhexa-1,3-dienyl]-2,8-diazaspiro[4.5]decan-3-one;ethane (PubChem CID 145197878) has the molecular formula C17H32N4O and a molecular weight of 308.47 g/mol. Its IUPAC name is 8-[(1E,3Z)-1,4-diamino-5-methylhexa-1,3-dienyl]-2,8-diazaspiro[4.5]decan-3-one;ethane.
| Compound Name | 8-[(1E,3Z)-1,4-diamino-5-methylhexa-1,3-dienyl]-2,8-diazaspiro[4.5]decan-3-one;ethane |
|---|---|
| PubChem CID | 145197878 |
| Molecular Formula | C17H32N4O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | 8-[(1E,3Z)-1,4-diamino-5-methylhexa-1,3-dienyl]-2,8-diazaspiro[4.5]decan-3-one;ethane |
| SMILES | CC.CC(C)/C(N)=C/C=C(\N)N1CCC2(CC1)CNC(=O)C2 |
| InChI | InChI=1S/C15H26N4O.C2H6/c1-11(2)12(16)3-4-13(17)19-7-5-15(6-8-19)9-14(20)18-10-15;1-2/h3-4,11H,5-10,16-17H2,1-2H3,(H,18,20);1-2H3/b12-3-,13-4+; |
| InChIKey | DHIXIIWSLGGGEO-FBGPQLBHSA-N |
| XLogP | 1.91 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|