C15H24N2O — CID 145197942
ethane;5-[(Z)-1-prop-1-en-2-yliminobut-2-en-2-yl]-1,2,3,4-tetrahydroazepin-7-one (PubChem CID 145197942) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is ethane;5-[(Z)-1-prop-1-en-2-yliminobut-2-en-2-yl]-1,2,3,4-tetrahydroazepin-7-one.
| Compound Name | ethane;5-[(Z)-1-prop-1-en-2-yliminobut-2-en-2-yl]-1,2,3,4-tetrahydroazepin-7-one |
|---|---|
| PubChem CID | 145197942 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | ethane;5-[(Z)-1-prop-1-en-2-yliminobut-2-en-2-yl]-1,2,3,4-tetrahydroazepin-7-one |
| SMILES | C=C(C)/N=C/C(=C\C)C1=CC(=O)NCCC1.CC |
| InChI | InChI=1S/C13H18N2O.C2H6/c1-4-11(9-15-10(2)3)12-6-5-7-14-13(16)8-12;1-2/h4,8-9H,2,5-7H2,1,3H3,(H,14,16);1-2H3/b11-4+,15-9+; |
| InChIKey | VGSRMCIYNHNNHZ-NSPZQVCQSA-N |
| XLogP | 3.40 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|