C13H23F3N4 — CID 145197970
(1E,3Z)-5,5-dimethyl-1-[3-(trifluoromethyl)piperazin-1-yl]hexa-1,3-diene-1,4-diamine (PubChem CID 145197970) has the molecular formula C13H23F3N4 and a molecular weight of 292.35 g/mol. Its IUPAC name is (1E,3Z)-5,5-dimethyl-1-[3-(trifluoromethyl)piperazin-1-yl]hexa-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-5,5-dimethyl-1-[3-(trifluoromethyl)piperazin-1-yl]hexa-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 145197970 |
| Molecular Formula | C13H23F3N4 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (1E,3Z)-5,5-dimethyl-1-[3-(trifluoromethyl)piperazin-1-yl]hexa-1,3-diene-1,4-diamine |
| SMILES | CC(C)(C)/C(N)=C/C=C(\N)N1CCNC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H23F3N4/c1-12(2,3)9(17)4-5-11(18)20-7-6-19-10(8-20)13(14,15)16/h4-5,10,19H,6-8,17-18H2,1-3H3/b9-4-,11-5+ |
| InChIKey | OCRUBSBETBVAMA-WNEGIOFOSA-N |
| XLogP | 1.51 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|