About ethane;(2Z,4E)-N-methyl-2-(piperazin-1-ylmethyl)hexa-2,4-dien-1-imine
ethane;(2Z,4E)-N-methyl-2-(piperazin-1-ylmethyl)hexa-2,4-dien-1-imine (PubChem CID 145197989) has the molecular formula C14H27N3
and a molecular weight of 237.39 g/mol. Its IUPAC name is ethane;(2Z,4E)-N-methyl-2-(piperazin-1-ylmethyl)hexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | ethane;(2Z,4E)-N-methyl-2-(piperazin-1-ylmethyl)hexa-2,4-dien-1-imine |
| PubChem CID | 145197989 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | ethane;(2Z,4E)-N-methyl-2-(piperazin-1-ylmethyl)hexa-2,4-dien-1-imine |
| SMILES | C/C=C/C=C(\C=N\C)CN1CCNCC1.CC |
| InChI | InChI=1S/C12H21N3.C2H6/c1-3-4-5-12(10-13-2)11-15-8-6-14-7-9-15;1-2/h3-5,10,14H,6-9,11H2,1-2H3;1-2H3/b4-3+,12-5+,13-10+; |
| InChIKey | WUWJQACGUMJJHK-LCVSSWRCSA-N |
| XLogP | 2.12 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2Z,4E)-N-methyl-2-(piperazin-1-ylmethyl)hexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2Z,4E)-N-methyl-2-(piperazin-1-ylmethyl)hexa-2,4-dien-1-imine?
The IUPAC name of ethane;(2Z,4E)-N-methyl-2-(piperazin-1-ylmethyl)hexa-2,4-dien-1-imine (CID 145197989) is ethane;(2Z,4E)-N-methyl-2-(piperazin-1-ylmethyl)hexa-2,4-dien-1-imine.
What is the SMILES notation for ethane;(2Z,4E)-N-methyl-2-(piperazin-1-ylmethyl)hexa-2,4-dien-1-imine?
The canonical SMILES for ethane;(2Z,4E)-N-methyl-2-(piperazin-1-ylmethyl)hexa-2,4-dien-1-imine is C/C=C/C=C(\C=N\C)CN1CCNCC1.CC.
What is the InChIKey of ethane;(2Z,4E)-N-methyl-2-(piperazin-1-ylmethyl)hexa-2,4-dien-1-imine?
The InChIKey is WUWJQACGUMJJHK-LCVSSWRCSA-N. The full InChI is InChI=1S/C12H21N3.C2H6/c1-3-4-5-12(10-13-2)11-15-8-6-14-7-9-15;1-2/h3-5,10,14H,6-9,11H2,1-2H3;1-2H3/b4-3+,12-5+,13-10+;.
What are the key properties of ethane;(2Z,4E)-N-methyl-2-(piperazin-1-ylmethyl)hexa-2,4-dien-1-imine?
ethane;(2Z,4E)-N-methyl-2-(piperazin-1-ylmethyl)hexa-2,4-dien-1-imine has a molecular weight of 237.39 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2Z,4E)-N-methyl-2-(piperazin-1-ylmethyl)hexa-2,4-dien-1-imine is sourced from PubChem (CID 145197989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).