C15H29N3 — CID 145198185
N,N-dimethyl-2-(3-methylidene-4-prop-1-en-2-yliminopiperidin-1-yl)ethanamine;ethane (PubChem CID 145198185) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is N,N-dimethyl-2-(3-methylidene-4-prop-1-en-2-yliminopiperidin-1-yl)ethanamine;ethane.
| Compound Name | N,N-dimethyl-2-(3-methylidene-4-prop-1-en-2-yliminopiperidin-1-yl)ethanamine;ethane |
|---|---|
| PubChem CID | 145198185 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | N,N-dimethyl-2-(3-methylidene-4-prop-1-en-2-yliminopiperidin-1-yl)ethanamine;ethane |
| SMILES | C=C(C)/N=C1\CCN(CCN(C)C)CC1=C.CC |
| InChI | InChI=1S/C13H23N3.C2H6/c1-11(2)14-13-6-7-16(10-12(13)3)9-8-15(4)5;1-2/h1,3,6-10H2,2,4-5H3;1-2H3/b14-13+; |
| InChIKey | CTTNBFIOBBPVTG-IERUDJENSA-N |
| XLogP | 2.81 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|