C15H29N3 — CID 145198219
ethane;(Z)-2-(piperazin-1-ylmethyl)-N-prop-1-en-2-ylpent-2-en-1-imine (PubChem CID 145198219) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is ethane;(Z)-2-(piperazin-1-ylmethyl)-N-prop-1-en-2-ylpent-2-en-1-imine.
| Compound Name | ethane;(Z)-2-(piperazin-1-ylmethyl)-N-prop-1-en-2-ylpent-2-en-1-imine |
|---|---|
| PubChem CID | 145198219 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | ethane;(Z)-2-(piperazin-1-ylmethyl)-N-prop-1-en-2-ylpent-2-en-1-imine |
| SMILES | C=C(C)/N=C/C(=C\CC)CN1CCNCC1.CC |
| InChI | InChI=1S/C13H23N3.C2H6/c1-4-5-13(10-15-12(2)3)11-16-8-6-14-7-9-16;1-2/h5,10,14H,2,4,6-9,11H2,1,3H3;1-2H3/b13-5+,15-10+; |
| InChIKey | SFBXUCZGXMVYCL-KUVOYXACSA-N |
| XLogP | 2.86 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|