C14H25N3 — CID 145198390
N-prop-1-en-2-yl-2-[(4-propylpiperazin-1-yl)methyl]prop-2-en-1-imine (PubChem CID 145198390) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is N-prop-1-en-2-yl-2-[(4-propylpiperazin-1-yl)methyl]prop-2-en-1-imine.
| Compound Name | N-prop-1-en-2-yl-2-[(4-propylpiperazin-1-yl)methyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 145198390 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N-prop-1-en-2-yl-2-[(4-propylpiperazin-1-yl)methyl]prop-2-en-1-imine |
| SMILES | C=C(/C=N/C(=C)C)CN1CCN(CCC)CC1 |
| InChI | InChI=1S/C14H25N3/c1-5-6-16-7-9-17(10-8-16)12-14(4)11-15-13(2)3/h11H,2,4-10,12H2,1,3H3/b15-11+ |
| InChIKey | YQYGQRRXZWTRQD-RVDMUPIBSA-N |
| XLogP | 2.17 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|