About (2E)-4-(ethenyliminomethyl)-N,3-dimethylpenta-2,4-dienamide
(2E)-4-(ethenyliminomethyl)-N,3-dimethylpenta-2,4-dienamide (PubChem CID 145198431) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is (2E)-4-(ethenyliminomethyl)-N,3-dimethylpenta-2,4-dienamide.
Molecular Properties
| Compound Name | (2E)-4-(ethenyliminomethyl)-N,3-dimethylpenta-2,4-dienamide |
| PubChem CID | 145198431 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (2E)-4-(ethenyliminomethyl)-N,3-dimethylpenta-2,4-dienamide |
| SMILES | C=C/N=C/C(=C)/C(C)=C/C(=O)NC |
| InChI | InChI=1S/C10H14N2O/c1-5-12-7-9(3)8(2)6-10(13)11-4/h5-7H,1,3H2,2,4H3,(H,11,13)/b8-6+,12-7+ |
| InChIKey | CLWHTBFLYSOSDI-ULBORTECSA-N |
| XLogP | 1.45 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-(ethenyliminomethyl)-N,3-dimethylpenta-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-(ethenyliminomethyl)-N,3-dimethylpenta-2,4-dienamide?
The IUPAC name of (2E)-4-(ethenyliminomethyl)-N,3-dimethylpenta-2,4-dienamide (CID 145198431) is (2E)-4-(ethenyliminomethyl)-N,3-dimethylpenta-2,4-dienamide.
What is the SMILES notation for (2E)-4-(ethenyliminomethyl)-N,3-dimethylpenta-2,4-dienamide?
The canonical SMILES for (2E)-4-(ethenyliminomethyl)-N,3-dimethylpenta-2,4-dienamide is C=C/N=C/C(=C)/C(C)=C/C(=O)NC.
What is the InChIKey of (2E)-4-(ethenyliminomethyl)-N,3-dimethylpenta-2,4-dienamide?
The InChIKey is CLWHTBFLYSOSDI-ULBORTECSA-N. The full InChI is InChI=1S/C10H14N2O/c1-5-12-7-9(3)8(2)6-10(13)11-4/h5-7H,1,3H2,2,4H3,(H,11,13)/b8-6+,12-7+.
What are the key properties of (2E)-4-(ethenyliminomethyl)-N,3-dimethylpenta-2,4-dienamide?
(2E)-4-(ethenyliminomethyl)-N,3-dimethylpenta-2,4-dienamide has a molecular weight of 178.23 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-(ethenyliminomethyl)-N,3-dimethylpenta-2,4-dienamide is sourced from PubChem (CID 145198431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).