C11H7NO2 — CID 145198490
1-cyclohepta-1,3,5,6-tetraen-1-ylpyrrole-2,5-dione (PubChem CID 145198490) has the molecular formula C11H7NO2 and a molecular weight of 185.18 g/mol. Its IUPAC name is 1-cyclohepta-1,3,5,6-tetraen-1-ylpyrrole-2,5-dione.
| Compound Name | 1-cyclohepta-1,3,5,6-tetraen-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 145198490 |
| Molecular Formula | C11H7NO2 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 1-cyclohepta-1,3,5,6-tetraen-1-ylpyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1C1=CC=CC=C=C1 |
| InChI | InChI=1S/C11H7NO2/c13-10-7-8-11(14)12(10)9-5-3-1-2-4-6-9/h1-3,5-8H |
| InChIKey | WAVGPJXKCJJLRQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|