C21H36KN7O — CID 145198515
potassium 7-(diaminomethylideneamino)heptyl-[3-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenoxy]propylamino]azanide (PubChem CID 145198515) has the molecular formula C21H36KN7O and a molecular weight of 441.67 g/mol. Its IUPAC name is potassium 7-(diaminomethylideneamino)heptyl-[3-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenoxy]propylamino]azanide.
| Compound Name | potassium 7-(diaminomethylideneamino)heptyl-[3-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenoxy]propylamino]azanide |
|---|---|
| PubChem CID | 145198515 |
| Molecular Formula | C21H36KN7O |
| Molecular Weight | 441.67 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | potassium 7-(diaminomethylideneamino)heptyl-[3-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenoxy]propylamino]azanide |
| SMILES | NC(N)=NCCCCCCC[N-]NCCCOc1ccc(C2=NCCCN2)cc1.[K+] |
| InChI | InChI=1S/C21H36N7O.K/c22-21(23)26-12-4-2-1-3-5-15-27-28-16-7-17-29-19-10-8-18(9-11-19)20-24-13-6-14-25-20;/h8-11,28H,1-7,12-17H2,(H,24,25)(H4,22,23,26);/q-1;+1 |
| InChIKey | UEGNMEDDBBRSIB-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.67 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|