C16H16F3N5O — CID 145198594
(Z)-3-amino-N'-[2-[hydroxy-(2,3,4-trifluorophenyl)methyl]-6-methylpyrimidin-4-yl]but-2-enimidamide (PubChem CID 145198594) has the molecular formula C16H16F3N5O and a molecular weight of 351.33 g/mol. Its IUPAC name is (Z)-3-amino-N'-[2-[hydroxy-(2,3,4-trifluorophenyl)methyl]-6-methylpyrimidin-4-yl]but-2-enimidamide.
| Compound Name | (Z)-3-amino-N'-[2-[hydroxy-(2,3,4-trifluorophenyl)methyl]-6-methylpyrimidin-4-yl]but-2-enimidamide |
|---|---|
| PubChem CID | 145198594 |
| Molecular Formula | C16H16F3N5O |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (Z)-3-amino-N'-[2-[hydroxy-(2,3,4-trifluorophenyl)methyl]-6-methylpyrimidin-4-yl]but-2-enimidamide |
| SMILES | C/C(N)=C/C(N)=N/c1cc(C)nc(C(O)c2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C16H16F3N5O/c1-7(20)5-11(21)23-12-6-8(2)22-16(24-12)15(25)9-3-4-10(17)14(19)13(9)18/h3-6,15,25H,20H2,1-2H3,(H2,21,22,23,24)/b7-5- |
| InChIKey | MSHXCCTZYNVBGN-ALCCZGGFSA-N |
| XLogP | 2.14 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|