About 1,2-difluoro-N,2-bis(trifluoromethyl)but-3-en-1-amine
1,2-difluoro-N,2-bis(trifluoromethyl)but-3-en-1-amine (PubChem CID 145199410) has the molecular formula C6H5F8N
and a molecular weight of 243.10 g/mol. Its IUPAC name is 1,2-difluoro-N,2-bis(trifluoromethyl)but-3-en-1-amine.
Molecular Properties
| Compound Name | 1,2-difluoro-N,2-bis(trifluoromethyl)but-3-en-1-amine |
| PubChem CID | 145199410 |
| Molecular Formula | C6H5F8N |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 1,2-difluoro-N,2-bis(trifluoromethyl)but-3-en-1-amine |
| SMILES | C=CC(F)(C(F)NC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H5F8N/c1-2-4(8,5(9,10)11)3(7)15-6(12,13)14/h2-3,15H,1H2 |
| InChIKey | UXFZRXPHMOCFQE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1,2-difluoro-N,2-bis(trifluoromethyl)but-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluoro-N,2-bis(trifluoromethyl)but-3-en-1-amine?
The IUPAC name of 1,2-difluoro-N,2-bis(trifluoromethyl)but-3-en-1-amine (CID 145199410) is 1,2-difluoro-N,2-bis(trifluoromethyl)but-3-en-1-amine.
What is the SMILES notation for 1,2-difluoro-N,2-bis(trifluoromethyl)but-3-en-1-amine?
The canonical SMILES for 1,2-difluoro-N,2-bis(trifluoromethyl)but-3-en-1-amine is C=CC(F)(C(F)NC(F)(F)F)C(F)(F)F.
What is the InChIKey of 1,2-difluoro-N,2-bis(trifluoromethyl)but-3-en-1-amine?
The InChIKey is UXFZRXPHMOCFQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F8N/c1-2-4(8,5(9,10)11)3(7)15-6(12,13)14/h2-3,15H,1H2.
What are the key properties of 1,2-difluoro-N,2-bis(trifluoromethyl)but-3-en-1-amine?
1,2-difluoro-N,2-bis(trifluoromethyl)but-3-en-1-amine has a molecular weight of 243.10 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluoro-N,2-bis(trifluoromethyl)but-3-en-1-amine is sourced from PubChem (CID 145199410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).