C22H30N2O — CID 145199616
N-[4-[(3E,5E)-3-ethyl-5-methylhepta-1,3,5-trien-4-yl]-2-methanimidoylphenyl]oxan-2-amine (PubChem CID 145199616) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is N-[4-[(3E,5E)-3-ethyl-5-methylhepta-1,3,5-trien-4-yl]-2-methanimidoylphenyl]oxan-2-amine.
| Compound Name | N-[4-[(3E,5E)-3-ethyl-5-methylhepta-1,3,5-trien-4-yl]-2-methanimidoylphenyl]oxan-2-amine |
|---|---|
| PubChem CID | 145199616 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | N-[4-[(3E,5E)-3-ethyl-5-methylhepta-1,3,5-trien-4-yl]-2-methanimidoylphenyl]oxan-2-amine |
| SMILES | [H]/N=C/c1cc(C(/C(C)=C/C)=C(/C=C)CC)ccc1NC1CCCCO1 |
| InChI | InChI=1S/C22H30N2O/c1-5-16(4)22(17(6-2)7-3)18-11-12-20(19(14-18)15-23)24-21-10-8-9-13-25-21/h5-6,11-12,14-15,21,23-24H,2,7-10,13H2,1,3-4H3/b16-5+,22-17-,23-15+ |
| InChIKey | YUAYSLZBNWGUCB-JSNMCEJOSA-N |
| XLogP | 5.94 |
| TPSA | 45.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|