C9H11BrF5NO — CID 145199727
4-bromo-N-methyl-N-(3,3,4,4,4-pentafluorobutyl)but-2-enamide (PubChem CID 145199727) has the molecular formula C9H11BrF5NO and a molecular weight of 324.09 g/mol. Its IUPAC name is 4-bromo-N-methyl-N-(3,3,4,4,4-pentafluorobutyl)but-2-enamide.
| Compound Name | 4-bromo-N-methyl-N-(3,3,4,4,4-pentafluorobutyl)but-2-enamide |
|---|---|
| PubChem CID | 145199727 |
| Molecular Formula | C9H11BrF5NO |
| Molecular Weight | 324.09 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | 4-bromo-N-methyl-N-(3,3,4,4,4-pentafluorobutyl)but-2-enamide |
| SMILES | CN(CCC(F)(F)C(F)(F)F)C(=O)C=CCBr |
| InChI | InChI=1S/C9H11BrF5NO/c1-16(7(17)3-2-5-10)6-4-8(11,12)9(13,14)15/h2-3H,4-6H2,1H3 |
| InChIKey | RMEKFGGNZDYEEU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.09 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|