C43H49N3 — CID 145199927
N-cyclohexyl-4-[(E)-1-[4-[3-[3-ethenyl-2,5-dimethylidene-4-[(Z)-prop-1-enyl]pyrrol-1-yl]propyl]phenyl]-2-phenylbut-1-enyl]-2-methanimidoylaniline (PubChem CID 145199927) has the molecular formula C43H49N3 and a molecular weight of 607.89 g/mol. Its IUPAC name is N-cyclohexyl-4-[(E)-1-[4-[3-[3-ethenyl-2,5-dimethylidene-4-[(Z)-prop-1-enyl]pyrrol-1-yl]propyl]phenyl]-2-phenylbut-1-enyl]-2-methanimidoylaniline.
| Compound Name | N-cyclohexyl-4-[(E)-1-[4-[3-[3-ethenyl-2,5-dimethylidene-4-[(Z)-prop-1-enyl]pyrrol-1-yl]propyl]phenyl]-2-phenylbut-1-enyl]-2-methanimidoylaniline |
|---|---|
| PubChem CID | 145199927 |
| Molecular Formula | C43H49N3 |
| Molecular Weight | 607.89 g/mol |
| Exact Mass | 607.39 |
| IUPAC Name | N-cyclohexyl-4-[(E)-1-[4-[3-[3-ethenyl-2,5-dimethylidene-4-[(Z)-prop-1-enyl]pyrrol-1-yl]propyl]phenyl]-2-phenylbut-1-enyl]-2-methanimidoylaniline |
| SMILES | [H]/N=C/c1cc(/C(=C(\CC)c2ccccc2)c2ccc(CCCn3c(=C)c(C=C)c(/C=C\C)c3=C)cc2)ccc1NC1CCCCC1 |
| InChI | InChI=1S/C43H49N3/c1-6-16-41-32(5)46(31(4)39(41)7-2)28-15-17-33-22-24-35(25-23-33)43(40(8-3)34-18-11-9-12-19-34)36-26-27-42(37(29-36)30-44)45-38-20-13-10-14-21-38/h6-7,9,11-12,16,18-19,22-27,29-30,38,44-45H,2,4-5,8,10,13-15,17,20-21,28H2,1,3H3/b16-6-,43-40+,44-30+ |
| InChIKey | AQDWERUWUHXJIR-XQTOBMIHSA-N |
| XLogP | 9.73 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.89 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|