C28H40N2O — CID 145199940
ethane;N-[4-[(3E,5E,7E)-4-ethenyl-6-ethyl-7-methylnona-1,3,5,7-tetraen-5-yl]-2-methanimidoylphenyl]oxan-2-amine (PubChem CID 145199940) has the molecular formula C28H40N2O and a molecular weight of 420.64 g/mol. Its IUPAC name is ethane;N-[4-[(3E,5E,7E)-4-ethenyl-6-ethyl-7-methylnona-1,3,5,7-tetraen-5-yl]-2-methanimidoylphenyl]oxan-2-amine.
| Compound Name | ethane;N-[4-[(3E,5E,7E)-4-ethenyl-6-ethyl-7-methylnona-1,3,5,7-tetraen-5-yl]-2-methanimidoylphenyl]oxan-2-amine |
|---|---|
| PubChem CID | 145199940 |
| Molecular Formula | C28H40N2O |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | ethane;N-[4-[(3E,5E,7E)-4-ethenyl-6-ethyl-7-methylnona-1,3,5,7-tetraen-5-yl]-2-methanimidoylphenyl]oxan-2-amine |
| SMILES | CC.[H]/N=C/c1cc(C(/C(C=C)=C/C=C)=C(CC)/C(C)=C/C)ccc1NC1CCCCO1 |
| InChI | InChI=1S/C26H34N2O.C2H6/c1-6-12-20(8-3)26(23(9-4)19(5)7-2)21-14-15-24(22(17-21)18-27)28-25-13-10-11-16-29-25;1-2/h6-8,12,14-15,17-18,25,27-28H,1,3,9-11,13,16H2,2,4-5H3;1-2H3/b19-7+,20-12+,26-23+,27-18+; |
| InChIKey | MSAHWEYGLXCVFB-QWKMCBDRSA-N |
| XLogP | 8.08 |
| TPSA | 45.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|