C23H29N4OP — CID 145200146
7-(1-ethylpiperidin-4-yl)-2-[3-methanimidoyl-4-(methylamino)phenyl]-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one (PubChem CID 145200146) has the molecular formula C23H29N4OP and a molecular weight of 408.49 g/mol. Its IUPAC name is 7-(1-ethylpiperidin-4-yl)-2-[3-methanimidoyl-4-(methylamino)phenyl]-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one.
| Compound Name | 7-(1-ethylpiperidin-4-yl)-2-[3-methanimidoyl-4-(methylamino)phenyl]-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one |
|---|---|
| PubChem CID | 145200146 |
| Molecular Formula | C23H29N4OP |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 7-(1-ethylpiperidin-4-yl)-2-[3-methanimidoyl-4-(methylamino)phenyl]-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one |
| SMILES | [H]/N=C/c1cc(C2=CC(=O)N3C=C(C4CCN(CC)CC4)C=CC3P2)ccc1NC |
| InChI | InChI=1S/C23H29N4OP/c1-3-26-10-8-16(9-11-26)18-5-7-23-27(15-18)22(28)13-21(29-23)17-4-6-20(25-2)19(12-17)14-24/h4-7,12-16,23-25,29H,3,8-11H2,1-2H3/b24-14+ |
| InChIKey | WOBXLJXLZOBNTE-ZVHZXABRSA-N |
| XLogP | 4.10 |
| TPSA | 59.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|