C22H24N6OS3 — CID 145201757
3-[(2,4-dimethyl-1,3-thiazol-5-yl)methylamino]-N-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide (PubChem CID 145201757) has the molecular formula C22H24N6OS3 and a molecular weight of 484.68 g/mol. Its IUPAC name is 3-[(2,4-dimethyl-1,3-thiazol-5-yl)methylamino]-N-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide.
| Compound Name | 3-[(2,4-dimethyl-1,3-thiazol-5-yl)methylamino]-N-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
|---|---|
| PubChem CID | 145201757 |
| Molecular Formula | C22H24N6OS3 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 3-[(2,4-dimethyl-1,3-thiazol-5-yl)methylamino]-N-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
| SMILES | Cc1nc(C)c(CNCCC(=O)Nc2sc3c(c2-c2nc4cnccc4s2)CCNC3)s1 |
| InChI | InChI=1S/C22H24N6OS3/c1-12-17(30-13(2)26-12)10-25-8-5-19(29)28-22-20(14-3-6-24-11-18(14)32-22)21-27-15-9-23-7-4-16(15)31-21/h4,7,9,24-25H,3,5-6,8,10-11H2,1-2H3,(H,28,29) |
| InChIKey | GRCFRTCPLTYGFR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|