C13H19ClN4O3 — CID 145201835
[1-[2-(5-chloro-1H-imidazol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamic acid (PubChem CID 145201835) has the molecular formula C13H19ClN4O3 and a molecular weight of 314.77 g/mol. Its IUPAC name is [1-[2-(5-chloro-1H-imidazol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamic acid.
| Compound Name | [1-[2-(5-chloro-1H-imidazol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 145201835 |
| Molecular Formula | C13H19ClN4O3 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [1-[2-(5-chloro-1H-imidazol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamic acid |
| SMILES | CC(C)C(NC(=O)O)C(=O)N1CCCC1c1ncc(Cl)[nH]1 |
| InChI | InChI=1S/C13H19ClN4O3/c1-7(2)10(17-13(20)21)12(19)18-5-3-4-8(18)11-15-6-9(14)16-11/h6-8,10,17H,3-5H2,1-2H3,(H,15,16)(H,20,21) |
| InChIKey | GQHLCSJIUMWZSI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |