C27H33F3N4O3S2 — CID 145202104
tert-butyl N-butan-2-yl-N-[3-oxo-3-[[3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]amino]propyl]carbamate (PubChem CID 145202104) has the molecular formula C27H33F3N4O3S2 and a molecular weight of 582.71 g/mol. Its IUPAC name is tert-butyl N-butan-2-yl-N-[3-oxo-3-[[3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-butan-2-yl-N-[3-oxo-3-[[3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 145202104 |
| Molecular Formula | C27H33F3N4O3S2 |
| Molecular Weight | 582.71 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | tert-butyl N-butan-2-yl-N-[3-oxo-3-[[3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]amino]propyl]carbamate |
| SMILES | CCC(C)N(CCC(=O)Nc1sc2c(c1-c1nc3cc(C(F)(F)F)ccc3s1)CCNC2)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H33F3N4O3S2/c1-6-15(2)34(25(36)37-26(3,4)5)12-10-21(35)33-24-22(17-9-11-31-14-20(17)39-24)23-32-18-13-16(27(28,29)30)7-8-19(18)38-23/h7-8,13,15,31H,6,9-12,14H2,1-5H3,(H,33,35) |
| InChIKey | TWRIOTRZHRUTIS-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.71 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |