C19H16Cl3N3O4S — CID 145203246
N-[4-(3-chlorophenoxy)-3-sulfamoylphenyl]-2-(2,4-dichloro-1,2-dihydropyridin-5-yl)acetamide (PubChem CID 145203246) has the molecular formula C19H16Cl3N3O4S and a molecular weight of 488.78 g/mol. Its IUPAC name is N-[4-(3-chlorophenoxy)-3-sulfamoylphenyl]-2-(2,4-dichloro-1,2-dihydropyridin-5-yl)acetamide.
| Compound Name | N-[4-(3-chlorophenoxy)-3-sulfamoylphenyl]-2-(2,4-dichloro-1,2-dihydropyridin-5-yl)acetamide |
|---|---|
| PubChem CID | 145203246 |
| Molecular Formula | C19H16Cl3N3O4S |
| Molecular Weight | 488.78 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | N-[4-(3-chlorophenoxy)-3-sulfamoylphenyl]-2-(2,4-dichloro-1,2-dihydropyridin-5-yl)acetamide |
| SMILES | NS(=O)(=O)c1cc(NC(=O)CC2=CNC(Cl)C=C2Cl)ccc1Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H16Cl3N3O4S/c20-12-2-1-3-14(7-12)29-16-5-4-13(8-17(16)30(23,27)28)25-19(26)6-11-10-24-18(22)9-15(11)21/h1-5,7-10,18,24H,6H2,(H,25,26)(H2,23,27,28) |
| InChIKey | HSEJDRZKNZSMFY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.78 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|