C29H38O2 — CID 145203334
(3E)-3-[[4-[(E)-(2-ethyl-3,3,4,4-tetramethyl-5-oxocyclopentylidene)methyl]phenyl]methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 145203334) has the molecular formula C29H38O2 and a molecular weight of 418.62 g/mol. Its IUPAC name is (3E)-3-[[4-[(E)-(2-ethyl-3,3,4,4-tetramethyl-5-oxocyclopentylidene)methyl]phenyl]methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (3E)-3-[[4-[(E)-(2-ethyl-3,3,4,4-tetramethyl-5-oxocyclopentylidene)methyl]phenyl]methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 145203334 |
| Molecular Formula | C29H38O2 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (3E)-3-[[4-[(E)-(2-ethyl-3,3,4,4-tetramethyl-5-oxocyclopentylidene)methyl]phenyl]methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CCC1/C(=C\c2ccc(/C=C3/C(=O)C4(C)CCC3C4(C)C)cc2)C(=O)C(C)(C)C1(C)C |
| InChI | InChI=1S/C29H38O2/c1-9-22-20(24(30)28(6,7)26(22,2)3)16-18-10-12-19(13-11-18)17-21-23-14-15-29(8,25(21)31)27(23,4)5/h10-13,16-17,22-23H,9,14-15H2,1-8H3/b20-16+,21-17+ |
| InChIKey | WEDIFGOLOKDWRO-NWILIBCHSA-N |
| XLogP | 7.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|