C19H41KN4O3S3 — CID 145204140
potassium;2-(butylamino)-N-(2-methylpropyl)acetamide;3-hydroxypropyl-[1-(methyltrisulfanyl)-2-oxo-2-(propylamino)ethyl]azanide (PubChem CID 145204140) has the molecular formula C19H41KN4O3S3 and a molecular weight of 508.86 g/mol. Its IUPAC name is potassium;2-(butylamino)-N-(2-methylpropyl)acetamide;3-hydroxypropyl-[1-(methyltrisulfanyl)-2-oxo-2-(propylamino)ethyl]azanide.
| Compound Name | potassium;2-(butylamino)-N-(2-methylpropyl)acetamide;3-hydroxypropyl-[1-(methyltrisulfanyl)-2-oxo-2-(propylamino)ethyl]azanide |
|---|---|
| PubChem CID | 145204140 |
| Molecular Formula | C19H41KN4O3S3 |
| Molecular Weight | 508.86 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | potassium;2-(butylamino)-N-(2-methylpropyl)acetamide;3-hydroxypropyl-[1-(methyltrisulfanyl)-2-oxo-2-(propylamino)ethyl]azanide |
| SMILES | CCCCNCC(=O)NCC(C)C.CCCNC(=O)C([N-]CCCO)SSSC.[K+] |
| InChI | InChI=1S/C10H22N2O.C9H19N2O2S3.K/c1-4-5-6-11-8-10(13)12-7-9(2)3;1-3-5-10-8(13)9(15-16-14-2)11-6-4-7-12;/h9,11H,4-8H2,1-3H3,(H,12,13);9,12H,3-7H2,1-2H3,(H,10,13);/q;-1;+1 |
| InChIKey | DMZSYPMACNYHMP-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 104.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.86 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|