C22H25FO2 — CID 145204705
7-[(1E,3Z)-2-fluoropenta-1,3-dienyl]-6-methyl-3-phenyl-3,5,5a,6,7,9a-hexahydro-2H-1-benzoxepin-4-one (PubChem CID 145204705) has the molecular formula C22H25FO2 and a molecular weight of 340.44 g/mol. Its IUPAC name is 7-[(1E,3Z)-2-fluoropenta-1,3-dienyl]-6-methyl-3-phenyl-3,5,5a,6,7,9a-hexahydro-2H-1-benzoxepin-4-one.
| Compound Name | 7-[(1E,3Z)-2-fluoropenta-1,3-dienyl]-6-methyl-3-phenyl-3,5,5a,6,7,9a-hexahydro-2H-1-benzoxepin-4-one |
|---|---|
| PubChem CID | 145204705 |
| Molecular Formula | C22H25FO2 |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 7-[(1E,3Z)-2-fluoropenta-1,3-dienyl]-6-methyl-3-phenyl-3,5,5a,6,7,9a-hexahydro-2H-1-benzoxepin-4-one |
| SMILES | C/C=C\C(F)=C/C1C=CC2OCC(c3ccccc3)C(=O)CC2C1C |
| InChI | InChI=1S/C22H25FO2/c1-3-7-18(23)12-17-10-11-22-19(15(17)2)13-21(24)20(14-25-22)16-8-5-4-6-9-16/h3-12,15,17,19-20,22H,13-14H2,1-2H3/b7-3-,18-12+ |
| InChIKey | OEYNOJDYKYWXBV-XLSKSXTDSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|