C22H18O3 — CID 145204735
2-[(3E)-hexa-1,3,5-trien-3-yl]-9,10-dihydro-8H-chromeno[7,6-f]chromen-1-one (PubChem CID 145204735) has the molecular formula C22H18O3 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]-9,10-dihydro-8H-chromeno[7,6-f]chromen-1-one.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-9,10-dihydro-8H-chromeno[7,6-f]chromen-1-one |
|---|---|
| PubChem CID | 145204735 |
| Molecular Formula | C22H18O3 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-9,10-dihydro-8H-chromeno[7,6-f]chromen-1-one |
| SMILES | C=C/C=C(\C=C)c1coc2ccc3cc4c(cc3c2c1=O)OCCC4 |
| InChI | InChI=1S/C22H18O3/c1-3-6-14(4-2)18-13-25-19-9-8-15-11-16-7-5-10-24-20(16)12-17(15)21(19)22(18)23/h3-4,6,8-9,11-13H,1-2,5,7,10H2/b14-6+ |
| InChIKey | CXQASJSYTWETLF-MKMNVTDBSA-N |
| XLogP | 5.03 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|