C19H15BrCl3NO — CID 145206706
6-bromo-4-chloro-2-[[2,6-dichloro-3-(1-methoxyethenyl)phenyl]methyl]-1-methylindole (PubChem CID 145206706) has the molecular formula C19H15BrCl3NO and a molecular weight of 459.60 g/mol. Its IUPAC name is 6-bromo-4-chloro-2-[[2,6-dichloro-3-(1-methoxyethenyl)phenyl]methyl]-1-methylindole.
| Compound Name | 6-bromo-4-chloro-2-[[2,6-dichloro-3-(1-methoxyethenyl)phenyl]methyl]-1-methylindole |
|---|---|
| PubChem CID | 145206706 |
| Molecular Formula | C19H15BrCl3NO |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 456.94 |
| IUPAC Name | 6-bromo-4-chloro-2-[[2,6-dichloro-3-(1-methoxyethenyl)phenyl]methyl]-1-methylindole |
| SMILES | C=C(OC)c1ccc(Cl)c(Cc2cc3c(Cl)cc(Br)cc3n2C)c1Cl |
| InChI | InChI=1S/C19H15BrCl3NO/c1-10(25-3)13-4-5-16(21)15(19(13)23)9-12-8-14-17(22)6-11(20)7-18(14)24(12)2/h4-8H,1,9H2,2-3H3 |
| InChIKey | CYVSMKCMBKGNNF-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|