C8H12N4 — CID 145206932
6-(methylaminomethyl)pyridine-3-carboximidamide (PubChem CID 145206932) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 6-(methylaminomethyl)pyridine-3-carboximidamide.
| Compound Name | 6-(methylaminomethyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 145206932 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 6-(methylaminomethyl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC)nc1 |
| InChI | InChI=1S/C8H12N4/c1-11-5-7-3-2-6(4-12-7)8(9)10/h2-4,11H,5H2,1H3,(H3,9,10) |
| InChIKey | XYLJFXHSNKRRQK-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|