About 1-methylcyclopent-3-ene-1-carbonitrile;propan-1-ol
1-methylcyclopent-3-ene-1-carbonitrile;propan-1-ol (PubChem CID 145207474) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-methylcyclopent-3-ene-1-carbonitrile;propan-1-ol.
Molecular Properties
| Compound Name | 1-methylcyclopent-3-ene-1-carbonitrile;propan-1-ol |
| PubChem CID | 145207474 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-methylcyclopent-3-ene-1-carbonitrile;propan-1-ol |
| SMILES | CC1(C#N)CC=CC1.CCCO |
| InChI | InChI=1S/C7H9N.C3H8O/c1-7(6-8)4-2-3-5-7;1-2-3-4/h2-3H,4-5H2,1H3;4H,2-3H2,1H3 |
| InChIKey | XDGHIOFHAHJGLX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methylcyclopent-3-ene-1-carbonitrile;propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylcyclopent-3-ene-1-carbonitrile;propan-1-ol?
The IUPAC name of 1-methylcyclopent-3-ene-1-carbonitrile;propan-1-ol (CID 145207474) is 1-methylcyclopent-3-ene-1-carbonitrile;propan-1-ol.
What is the SMILES notation for 1-methylcyclopent-3-ene-1-carbonitrile;propan-1-ol?
The canonical SMILES for 1-methylcyclopent-3-ene-1-carbonitrile;propan-1-ol is CC1(C#N)CC=CC1.CCCO.
What is the InChIKey of 1-methylcyclopent-3-ene-1-carbonitrile;propan-1-ol?
The InChIKey is XDGHIOFHAHJGLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C3H8O/c1-7(6-8)4-2-3-5-7;1-2-3-4/h2-3H,4-5H2,1H3;4H,2-3H2,1H3.
What are the key properties of 1-methylcyclopent-3-ene-1-carbonitrile;propan-1-ol?
1-methylcyclopent-3-ene-1-carbonitrile;propan-1-ol has a molecular weight of 167.25 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcyclopent-3-ene-1-carbonitrile;propan-1-ol is sourced from PubChem (CID 145207474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).