C27H20F5NO5S — CID 145207585
[(1S,2R)-2-[(2S)-6-(2,5-difluorophenyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]cyclopent-3-yn-1-yl]methanediol (PubChem CID 145207585) has the molecular formula C27H20F5NO5S and a molecular weight of 565.52 g/mol. Its IUPAC name is [(1S,2R)-2-[(2S)-6-(2,5-difluorophenyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]cyclopent-3-yn-1-yl]methanediol.
| Compound Name | [(1S,2R)-2-[(2S)-6-(2,5-difluorophenyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]cyclopent-3-yn-1-yl]methanediol |
|---|---|
| PubChem CID | 145207585 |
| Molecular Formula | C27H20F5NO5S |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 565.10 |
| IUPAC Name | [(1S,2R)-2-[(2S)-6-(2,5-difluorophenyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]cyclopent-3-yn-1-yl]methanediol |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N1C[C@H]([C@H]2C#CC[C@@H]2C(O)O)Oc2ccc(-c3cc(F)ccc3F)cc21 |
| InChI | InChI=1S/C27H20F5NO5S/c28-17-8-9-22(29)21(13-17)15-7-10-24-23(11-15)33(14-25(38-24)19-5-2-6-20(19)26(34)35)39(36,37)18-4-1-3-16(12-18)27(30,31)32/h1,3-4,7-13,19-20,25-26,34-35H,6,14H2/t19-,20-,25+/m0/s1 |
| InChIKey | WXMSHEFSOPLKFY-ZYLNGJIFSA-N |
| XLogP | 4.56 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|