C15H15Br4FO7 — CID 145207912
1-O-[2-(2-fluorooxyethoxy)ethyl] 2-O-(2-hydroxypropyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate (PubChem CID 145207912) has the molecular formula C15H15Br4FO7 and a molecular weight of 645.89 g/mol. Its IUPAC name is 1-O-[2-(2-fluorooxyethoxy)ethyl] 2-O-(2-hydroxypropyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate.
| Compound Name | 1-O-[2-(2-fluorooxyethoxy)ethyl] 2-O-(2-hydroxypropyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 145207912 |
| Molecular Formula | C15H15Br4FO7 |
| Molecular Weight | 645.89 g/mol |
| Exact Mass | 641.75 |
| IUPAC Name | 1-O-[2-(2-fluorooxyethoxy)ethyl] 2-O-(2-hydroxypropyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate |
| SMILES | CC(O)COC(=O)c1c(Br)c(Br)c(Br)c(Br)c1C(=O)OCCOCCOF |
| InChI | InChI=1S/C15H15Br4FO7/c1-7(21)6-26-15(23)9-8(10(16)12(18)13(19)11(9)17)14(22)25-4-2-24-3-5-27-20/h7,21H,2-6H2,1H3 |
| InChIKey | BVEOALCKICYAJB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.89 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|