C32H43FN4O3 — CID 145208454
ethane;ethyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(8-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methyl]-4-methylphenyl]propanoate (PubChem CID 145208454) has the molecular formula C32H43FN4O3 and a molecular weight of 550.72 g/mol. Its IUPAC name is ethane;ethyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(8-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methyl]-4-methylphenyl]propanoate.
| Compound Name | ethane;ethyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(8-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methyl]-4-methylphenyl]propanoate |
|---|---|
| PubChem CID | 145208454 |
| Molecular Formula | C32H43FN4O3 |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | ethane;ethyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(8-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methyl]-4-methylphenyl]propanoate |
| SMILES | CC.CCOC(=O)CC(c1ccc(C)c(CN2CCOc3cc(F)ccc3C2)c1)c1ccc(N(C)N)c(N)c1C |
| InChI | InChI=1S/C30H37FN4O3.C2H6/c1-5-37-29(36)16-26(25-10-11-27(34(4)33)30(32)20(25)3)21-7-6-19(2)23(14-21)18-35-12-13-38-28-15-24(31)9-8-22(28)17-35;1-2/h6-11,14-15,26H,5,12-13,16-18,32-33H2,1-4H3;1-2H3 |
| InChIKey | OCHRETJSZLAPKE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|