About (3E)-2-bromo-4-(chloromethyl)hexa-1,3,5-triene;ethane
(3E)-2-bromo-4-(chloromethyl)hexa-1,3,5-triene;ethane (PubChem CID 145208558) has the molecular formula C9H14BrCl
and a molecular weight of 237.57 g/mol. Its IUPAC name is (3E)-2-bromo-4-(chloromethyl)hexa-1,3,5-triene;ethane.
Molecular Properties
| Compound Name | (3E)-2-bromo-4-(chloromethyl)hexa-1,3,5-triene;ethane |
| PubChem CID | 145208558 |
| Molecular Formula | C9H14BrCl |
| Molecular Weight | 237.57 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | (3E)-2-bromo-4-(chloromethyl)hexa-1,3,5-triene;ethane |
| SMILES | C=C/C(=C\C(=C)Br)CCl.CC |
| InChI | InChI=1S/C7H8BrCl.C2H6/c1-3-7(5-9)4-6(2)8;1-2/h3-4H,1-2,5H2;1-2H3/b7-4+; |
| InChIKey | SUXWJRFNZHSZLR-KQGICBIGSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-2-bromo-4-(chloromethyl)hexa-1,3,5-triene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-2-bromo-4-(chloromethyl)hexa-1,3,5-triene;ethane?
The IUPAC name of (3E)-2-bromo-4-(chloromethyl)hexa-1,3,5-triene;ethane (CID 145208558) is (3E)-2-bromo-4-(chloromethyl)hexa-1,3,5-triene;ethane.
What is the SMILES notation for (3E)-2-bromo-4-(chloromethyl)hexa-1,3,5-triene;ethane?
The canonical SMILES for (3E)-2-bromo-4-(chloromethyl)hexa-1,3,5-triene;ethane is C=C/C(=C\C(=C)Br)CCl.CC.
What is the InChIKey of (3E)-2-bromo-4-(chloromethyl)hexa-1,3,5-triene;ethane?
The InChIKey is SUXWJRFNZHSZLR-KQGICBIGSA-N. The full InChI is InChI=1S/C7H8BrCl.C2H6/c1-3-7(5-9)4-6(2)8;1-2/h3-4H,1-2,5H2;1-2H3/b7-4+;.
What are the key properties of (3E)-2-bromo-4-(chloromethyl)hexa-1,3,5-triene;ethane?
(3E)-2-bromo-4-(chloromethyl)hexa-1,3,5-triene;ethane has a molecular weight of 237.57 g/mol, XLogP of 4.27, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-2-bromo-4-(chloromethyl)hexa-1,3,5-triene;ethane is sourced from PubChem (CID 145208558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).