C29H40 — CID 145209550
5,5'-diethyl-1,1,1',1',6-pentamethyl-6'-propan-2-yl-3,3'-spirobi[2H-indene] (PubChem CID 145209550) has the molecular formula C29H40 and a molecular weight of 388.64 g/mol. Its IUPAC name is 5,5'-diethyl-1,1,1',1',6-pentamethyl-6'-propan-2-yl-3,3'-spirobi[2H-indene].
| Compound Name | 5,5'-diethyl-1,1,1',1',6-pentamethyl-6'-propan-2-yl-3,3'-spirobi[2H-indene] |
|---|---|
| PubChem CID | 145209550 |
| Molecular Formula | C29H40 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.31 |
| IUPAC Name | 5,5'-diethyl-1,1,1',1',6-pentamethyl-6'-propan-2-yl-3,3'-spirobi[2H-indene] |
| SMILES | CCc1cc2c(cc1C)C(C)(C)CC21CC(C)(C)c2cc(C(C)C)c(CC)cc21 |
| InChI | InChI=1S/C29H40/c1-10-20-13-25-23(12-19(20)5)27(6,7)16-29(25)17-28(8,9)24-15-22(18(3)4)21(11-2)14-26(24)29/h12-15,18H,10-11,16-17H2,1-9H3 |
| InChIKey | RIFWXQKOVCDSCM-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |