About 3-fluoro-8-azaspiro[4.5]decane;N-methylacetamide
3-fluoro-8-azaspiro[4.5]decane;N-methylacetamide (PubChem CID 145210013) has the molecular formula C12H23FN2O
and a molecular weight of 230.33 g/mol. Its IUPAC name is 3-fluoro-8-azaspiro[4.5]decane;N-methylacetamide.
Molecular Properties
| Compound Name | 3-fluoro-8-azaspiro[4.5]decane;N-methylacetamide |
| PubChem CID | 145210013 |
| Molecular Formula | C12H23FN2O |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 3-fluoro-8-azaspiro[4.5]decane;N-methylacetamide |
| SMILES | CNC(C)=O.FC1CCC2(CCNCC2)C1 |
| InChI | InChI=1S/C9H16FN.C3H7NO/c10-8-1-2-9(7-8)3-5-11-6-4-9;1-3(5)4-2/h8,11H,1-7H2;1-2H3,(H,4,5) |
| InChIKey | UECPZTIVIHCQCP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-8-azaspiro[4.5]decane;N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-8-azaspiro[4.5]decane;N-methylacetamide?
The IUPAC name of 3-fluoro-8-azaspiro[4.5]decane;N-methylacetamide (CID 145210013) is 3-fluoro-8-azaspiro[4.5]decane;N-methylacetamide.
What is the SMILES notation for 3-fluoro-8-azaspiro[4.5]decane;N-methylacetamide?
The canonical SMILES for 3-fluoro-8-azaspiro[4.5]decane;N-methylacetamide is CNC(C)=O.FC1CCC2(CCNCC2)C1.
What is the InChIKey of 3-fluoro-8-azaspiro[4.5]decane;N-methylacetamide?
The InChIKey is UECPZTIVIHCQCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16FN.C3H7NO/c10-8-1-2-9(7-8)3-5-11-6-4-9;1-3(5)4-2/h8,11H,1-7H2;1-2H3,(H,4,5).
What are the key properties of 3-fluoro-8-azaspiro[4.5]decane;N-methylacetamide?
3-fluoro-8-azaspiro[4.5]decane;N-methylacetamide has a molecular weight of 230.33 g/mol, XLogP of 1.63, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-8-azaspiro[4.5]decane;N-methylacetamide is sourced from PubChem (CID 145210013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).