C26H31F2N3 — CID 145210524
(3Z)-2-N-[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]-5-N-[(3Z)-5-[[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]amino]hexa-1,3,5-trien-2-yl]hexa-1,3,5-triene-2,5-diamine (PubChem CID 145210524) has the molecular formula C26H31F2N3 and a molecular weight of 423.55 g/mol. Its IUPAC name is (3Z)-2-N-[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]-5-N-[(3Z)-5-[[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]amino]hexa-1,3,5-trien-2-yl]hexa-1,3,5-triene-2,5-diamine.
| Compound Name | (3Z)-2-N-[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]-5-N-[(3Z)-5-[[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]amino]hexa-1,3,5-trien-2-yl]hexa-1,3,5-triene-2,5-diamine |
|---|---|
| PubChem CID | 145210524 |
| Molecular Formula | C26H31F2N3 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | (3Z)-2-N-[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]-5-N-[(3Z)-5-[[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]amino]hexa-1,3,5-trien-2-yl]hexa-1,3,5-triene-2,5-diamine |
| SMILES | C=C(F)/C=C\C(=C)CNC(=C)/C=C\C(=C)NC(=C)/C=C\C(=C)NCC(=C)/C=C\C(=C)F |
| InChI | InChI=1S/C26H31F2N3/c1-19(9-11-21(3)27)17-29-23(5)13-15-25(7)31-26(8)16-14-24(6)30-18-20(2)10-12-22(4)28/h9-16,29-31H,1-8,17-18H2/b11-9-,12-10-,15-13-,16-14- |
| InChIKey | IYQWVLGFCHTUQN-LUHLCGLTSA-N |
| XLogP | 6.11 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|