About (Z)-3-amino-1-(5,6-dimethyl-1H-indol-2-yl)-2-methylbut-2-en-1-one
(Z)-3-amino-1-(5,6-dimethyl-1H-indol-2-yl)-2-methylbut-2-en-1-one (PubChem CID 145211090) has the molecular formula C15H18N2O
and a molecular weight of 242.32 g/mol. Its IUPAC name is (Z)-3-amino-1-(5,6-dimethyl-1H-indol-2-yl)-2-methylbut-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-3-amino-1-(5,6-dimethyl-1H-indol-2-yl)-2-methylbut-2-en-1-one |
| PubChem CID | 145211090 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | (Z)-3-amino-1-(5,6-dimethyl-1H-indol-2-yl)-2-methylbut-2-en-1-one |
| SMILES | C/C(N)=C(\C)C(=O)c1cc2cc(C)c(C)cc2[nH]1 |
| InChI | InChI=1S/C15H18N2O/c1-8-5-12-7-14(15(18)10(3)11(4)16)17-13(12)6-9(8)2/h5-7,17H,16H2,1-4H3/b11-10- |
| InChIKey | MTDSDLAQMCFBMN-KHPPLWFESA-N |
| XLogP | 3.22 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-1-(5,6-dimethyl-1H-indol-2-yl)-2-methylbut-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-1-(5,6-dimethyl-1H-indol-2-yl)-2-methylbut-2-en-1-one?
The IUPAC name of (Z)-3-amino-1-(5,6-dimethyl-1H-indol-2-yl)-2-methylbut-2-en-1-one (CID 145211090) is (Z)-3-amino-1-(5,6-dimethyl-1H-indol-2-yl)-2-methylbut-2-en-1-one.
What is the SMILES notation for (Z)-3-amino-1-(5,6-dimethyl-1H-indol-2-yl)-2-methylbut-2-en-1-one?
The canonical SMILES for (Z)-3-amino-1-(5,6-dimethyl-1H-indol-2-yl)-2-methylbut-2-en-1-one is C/C(N)=C(\C)C(=O)c1cc2cc(C)c(C)cc2[nH]1.
What is the InChIKey of (Z)-3-amino-1-(5,6-dimethyl-1H-indol-2-yl)-2-methylbut-2-en-1-one?
The InChIKey is MTDSDLAQMCFBMN-KHPPLWFESA-N. The full InChI is InChI=1S/C15H18N2O/c1-8-5-12-7-14(15(18)10(3)11(4)16)17-13(12)6-9(8)2/h5-7,17H,16H2,1-4H3/b11-10-.
What are the key properties of (Z)-3-amino-1-(5,6-dimethyl-1H-indol-2-yl)-2-methylbut-2-en-1-one?
(Z)-3-amino-1-(5,6-dimethyl-1H-indol-2-yl)-2-methylbut-2-en-1-one has a molecular weight of 242.32 g/mol, XLogP of 3.22, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-1-(5,6-dimethyl-1H-indol-2-yl)-2-methylbut-2-en-1-one is sourced from PubChem (CID 145211090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).