C22H25IN4O2S — CID 145211706
[6-(1-acetylpiperidin-4-yl)-2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-5-methylindol-1-yl] thiohypoiodite (PubChem CID 145211706) has the molecular formula C22H25IN4O2S and a molecular weight of 536.44 g/mol. Its IUPAC name is [6-(1-acetylpiperidin-4-yl)-2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-5-methylindol-1-yl] thiohypoiodite.
| Compound Name | [6-(1-acetylpiperidin-4-yl)-2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-5-methylindol-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 145211706 |
| Molecular Formula | C22H25IN4O2S |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | [6-(1-acetylpiperidin-4-yl)-2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-5-methylindol-1-yl] thiohypoiodite |
| SMILES | CC(=O)N1CCC(c2cc3c(cc2C)cc(C(=O)/C(C#N)=C/N(C)C)n3SI)CC1 |
| InChI | InChI=1S/C22H25IN4O2S/c1-14-9-17-10-21(22(29)18(12-24)13-25(3)4)27(30-23)20(17)11-19(14)16-5-7-26(8-6-16)15(2)28/h9-11,13,16H,5-8H2,1-4H3/b18-13+ |
| InChIKey | MAFNQXDTNOAWJO-QGOAFFKASA-N |
| XLogP | 4.67 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|