About 2-chloro-4-[(1E)-1-(methylideneamino)buta-1,3-dienoxy]aniline
2-chloro-4-[(1E)-1-(methylideneamino)buta-1,3-dienoxy]aniline (PubChem CID 145211976) has the molecular formula C11H11ClN2O
and a molecular weight of 222.67 g/mol. Its IUPAC name is 2-chloro-4-[(1E)-1-(methylideneamino)buta-1,3-dienoxy]aniline.
Molecular Properties
| Compound Name | 2-chloro-4-[(1E)-1-(methylideneamino)buta-1,3-dienoxy]aniline |
| PubChem CID | 145211976 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-chloro-4-[(1E)-1-(methylideneamino)buta-1,3-dienoxy]aniline |
| SMILES | C=C/C=C(\N=C)Oc1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C11H11ClN2O/c1-3-4-11(14-2)15-8-5-6-10(13)9(12)7-8/h3-7H,1-2,13H2/b11-4+ |
| InChIKey | XKVPTNNOFGORTA-NYYWCZLTSA-N |
| XLogP | 3.03 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-[(1E)-1-(methylideneamino)buta-1,3-dienoxy]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-[(1E)-1-(methylideneamino)buta-1,3-dienoxy]aniline?
The IUPAC name of 2-chloro-4-[(1E)-1-(methylideneamino)buta-1,3-dienoxy]aniline (CID 145211976) is 2-chloro-4-[(1E)-1-(methylideneamino)buta-1,3-dienoxy]aniline.
What is the SMILES notation for 2-chloro-4-[(1E)-1-(methylideneamino)buta-1,3-dienoxy]aniline?
The canonical SMILES for 2-chloro-4-[(1E)-1-(methylideneamino)buta-1,3-dienoxy]aniline is C=C/C=C(\N=C)Oc1ccc(N)c(Cl)c1.
What is the InChIKey of 2-chloro-4-[(1E)-1-(methylideneamino)buta-1,3-dienoxy]aniline?
The InChIKey is XKVPTNNOFGORTA-NYYWCZLTSA-N. The full InChI is InChI=1S/C11H11ClN2O/c1-3-4-11(14-2)15-8-5-6-10(13)9(12)7-8/h3-7H,1-2,13H2/b11-4+.
What are the key properties of 2-chloro-4-[(1E)-1-(methylideneamino)buta-1,3-dienoxy]aniline?
2-chloro-4-[(1E)-1-(methylideneamino)buta-1,3-dienoxy]aniline has a molecular weight of 222.67 g/mol, XLogP of 3.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[(1E)-1-(methylideneamino)buta-1,3-dienoxy]aniline is sourced from PubChem (CID 145211976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).