About [2-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]methanamine
[2-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]methanamine (PubChem CID 145212114) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is [2-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]methanamine.
Molecular Properties
| Compound Name | [2-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]methanamine |
| PubChem CID | 145212114 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | [2-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]methanamine |
| SMILES | CC/C=C\C=C/Cc1ccccc1CN |
| InChI | InChI=1S/C14H19N/c1-2-3-4-5-6-9-13-10-7-8-11-14(13)12-15/h3-8,10-11H,2,9,12,15H2,1H3/b4-3-,6-5- |
| InChIKey | OOLGQWHGQYBRBH-OUPQRBNQSA-N |
| XLogP | 3.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]methanamine?
The IUPAC name of [2-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]methanamine (CID 145212114) is [2-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]methanamine.
What is the SMILES notation for [2-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]methanamine?
The canonical SMILES for [2-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]methanamine is CC/C=C\C=C/Cc1ccccc1CN.
What is the InChIKey of [2-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]methanamine?
The InChIKey is OOLGQWHGQYBRBH-OUPQRBNQSA-N. The full InChI is InChI=1S/C14H19N/c1-2-3-4-5-6-9-13-10-7-8-11-14(13)12-15/h3-8,10-11H,2,9,12,15H2,1H3/b4-3-,6-5-.
What are the key properties of [2-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]methanamine?
[2-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]methanamine has a molecular weight of 201.31 g/mol, XLogP of 3.21, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]methanamine is sourced from PubChem (CID 145212114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).