C48H42N2 — CID 145212546
buta-1,3-diene;3-ethyl-6-[4-[9-[(2E,4Z)-hexa-2,4-dien-3-yl]carbazol-3-yl]phenyl]-9-phenylcarbazole (PubChem CID 145212546) has the molecular formula C48H42N2 and a molecular weight of 646.88 g/mol. Its IUPAC name is buta-1,3-diene;3-ethyl-6-[4-[9-[(2E,4Z)-hexa-2,4-dien-3-yl]carbazol-3-yl]phenyl]-9-phenylcarbazole.
| Compound Name | buta-1,3-diene;3-ethyl-6-[4-[9-[(2E,4Z)-hexa-2,4-dien-3-yl]carbazol-3-yl]phenyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 145212546 |
| Molecular Formula | C48H42N2 |
| Molecular Weight | 646.88 g/mol |
| Exact Mass | 646.33 |
| IUPAC Name | buta-1,3-diene;3-ethyl-6-[4-[9-[(2E,4Z)-hexa-2,4-dien-3-yl]carbazol-3-yl]phenyl]-9-phenylcarbazole |
| SMILES | C/C=C\C(=C/C)n1c2ccccc2c2cc(-c3ccc(-c4ccc5c(c4)c4cc(CC)ccc4n5-c4ccccc4)cc3)ccc21.C=CC=C |
| InChI | InChI=1S/C44H36N2.C4H6/c1-4-12-35(6-3)45-41-16-11-10-15-37(41)39-28-33(22-25-43(39)45)31-18-20-32(21-19-31)34-23-26-44-40(29-34)38-27-30(5-2)17-24-42(38)46(44)36-13-8-7-9-14-36;1-3-4-2/h4,6-29H,5H2,1-3H3;3-4H,1-2H2/b12-4-,35-6+; |
| InChIKey | CXIZIZAQTFWXBQ-OZMHOWIBSA-N |
| XLogP | 13.58 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.88 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|