About ethane;N-[(1Z)-1-(6-fluoro-2-methyl-3-pyridin-2-ylquinolin-4-yl)buta-1,3-dienyl]ethanimine
ethane;N-[(1Z)-1-(6-fluoro-2-methyl-3-pyridin-2-ylquinolin-4-yl)buta-1,3-dienyl]ethanimine (PubChem CID 145212591) has the molecular formula C23H24FN3
and a molecular weight of 361.46 g/mol. Its IUPAC name is ethane;N-[(1Z)-1-(6-fluoro-2-methyl-3-pyridin-2-ylquinolin-4-yl)buta-1,3-dienyl]ethanimine.
Molecular Properties
| Compound Name | ethane;N-[(1Z)-1-(6-fluoro-2-methyl-3-pyridin-2-ylquinolin-4-yl)buta-1,3-dienyl]ethanimine |
| PubChem CID | 145212591 |
| Molecular Formula | C23H24FN3 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | ethane;N-[(1Z)-1-(6-fluoro-2-methyl-3-pyridin-2-ylquinolin-4-yl)buta-1,3-dienyl]ethanimine |
| SMILES | C=C/C=C(\N=C\C)c1c(-c2ccccn2)c(C)nc2ccc(F)cc12.CC |
| InChI | InChI=1S/C21H18FN3.C2H6/c1-4-8-18(23-5-2)21-16-13-15(22)10-11-17(16)25-14(3)20(21)19-9-6-7-12-24-19;1-2/h4-13H,1H2,2-3H3;1-2H3/b18-8-,23-5+; |
| InChIKey | NVRQMOBZWYWHLG-KZEHXAAWSA-N |
| XLogP | 6.39 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(1Z)-1-(6-fluoro-2-methyl-3-pyridin-2-ylquinolin-4-yl)buta-1,3-dienyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(1Z)-1-(6-fluoro-2-methyl-3-pyridin-2-ylquinolin-4-yl)buta-1,3-dienyl]ethanimine?
The IUPAC name of ethane;N-[(1Z)-1-(6-fluoro-2-methyl-3-pyridin-2-ylquinolin-4-yl)buta-1,3-dienyl]ethanimine (CID 145212591) is ethane;N-[(1Z)-1-(6-fluoro-2-methyl-3-pyridin-2-ylquinolin-4-yl)buta-1,3-dienyl]ethanimine.
What is the SMILES notation for ethane;N-[(1Z)-1-(6-fluoro-2-methyl-3-pyridin-2-ylquinolin-4-yl)buta-1,3-dienyl]ethanimine?
The canonical SMILES for ethane;N-[(1Z)-1-(6-fluoro-2-methyl-3-pyridin-2-ylquinolin-4-yl)buta-1,3-dienyl]ethanimine is C=C/C=C(\N=C\C)c1c(-c2ccccn2)c(C)nc2ccc(F)cc12.CC.
What is the InChIKey of ethane;N-[(1Z)-1-(6-fluoro-2-methyl-3-pyridin-2-ylquinolin-4-yl)buta-1,3-dienyl]ethanimine?
The InChIKey is NVRQMOBZWYWHLG-KZEHXAAWSA-N. The full InChI is InChI=1S/C21H18FN3.C2H6/c1-4-8-18(23-5-2)21-16-13-15(22)10-11-17(16)25-14(3)20(21)19-9-6-7-12-24-19;1-2/h4-13H,1H2,2-3H3;1-2H3/b18-8-,23-5+;.
What are the key properties of ethane;N-[(1Z)-1-(6-fluoro-2-methyl-3-pyridin-2-ylquinolin-4-yl)buta-1,3-dienyl]ethanimine?
ethane;N-[(1Z)-1-(6-fluoro-2-methyl-3-pyridin-2-ylquinolin-4-yl)buta-1,3-dienyl]ethanimine has a molecular weight of 361.46 g/mol, XLogP of 6.39, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(1Z)-1-(6-fluoro-2-methyl-3-pyridin-2-ylquinolin-4-yl)buta-1,3-dienyl]ethanimine is sourced from PubChem (CID 145212591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).