C17H18FN3O — CID 145212635
ethane;6-fluoro-2-methyl-3-(pyridin-2-ylmethyl)quinazolin-4-one (PubChem CID 145212635) has the molecular formula C17H18FN3O and a molecular weight of 299.35 g/mol. Its IUPAC name is ethane;6-fluoro-2-methyl-3-(pyridin-2-ylmethyl)quinazolin-4-one.
| Compound Name | ethane;6-fluoro-2-methyl-3-(pyridin-2-ylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 145212635 |
| Molecular Formula | C17H18FN3O |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | ethane;6-fluoro-2-methyl-3-(pyridin-2-ylmethyl)quinazolin-4-one |
| SMILES | CC.Cc1nc2ccc(F)cc2c(=O)n1Cc1ccccn1 |
| InChI | InChI=1S/C15H12FN3O.C2H6/c1-10-18-14-6-5-11(16)8-13(14)15(20)19(10)9-12-4-2-3-7-17-12;1-2/h2-8H,9H2,1H3;1-2H3 |
| InChIKey | AHVMZOHXHOCLMB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |