C27H32ClN7O2 — CID 145213608
1-[(1Z)-1-[[2-(2-chloroanilino)-5-methylpyrimidin-4-yl]-ethenylhydrazinylidene]propan-2-yl]-3-[(1R)-1-(3-ethylphenyl)-2-hydroxyethyl]urea (PubChem CID 145213608) has the molecular formula C27H32ClN7O2 and a molecular weight of 522.05 g/mol. Its IUPAC name is 1-[(1Z)-1-[[2-(2-chloroanilino)-5-methylpyrimidin-4-yl]-ethenylhydrazinylidene]propan-2-yl]-3-[(1R)-1-(3-ethylphenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-[(1Z)-1-[[2-(2-chloroanilino)-5-methylpyrimidin-4-yl]-ethenylhydrazinylidene]propan-2-yl]-3-[(1R)-1-(3-ethylphenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 145213608 |
| Molecular Formula | C27H32ClN7O2 |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 1-[(1Z)-1-[[2-(2-chloroanilino)-5-methylpyrimidin-4-yl]-ethenylhydrazinylidene]propan-2-yl]-3-[(1R)-1-(3-ethylphenyl)-2-hydroxyethyl]urea |
| SMILES | C=CN(/N=C\C(C)NC(=O)N[C@@H](CO)c1cccc(CC)c1)c1nc(Nc2ccccc2Cl)ncc1C |
| InChI | InChI=1S/C27H32ClN7O2/c1-5-20-10-9-11-21(14-20)24(17-36)33-27(37)31-19(4)16-30-35(6-2)25-18(3)15-29-26(34-25)32-23-13-8-7-12-22(23)28/h6-16,19,24,36H,2,5,17H2,1,3-4H3,(H,29,32,34)(H2,31,33,37)/b30-16-/t19?,24-/m0/s1 |
| InChIKey | AGFNOBIAVGNAGG-JZVPMRMTSA-N |
| XLogP | 5.10 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|