About 1-methylpyrrolidine;4-[4-(8-methylquinolin-7-yl)phenoxy]piperidine-1-carbaldehyde
1-methylpyrrolidine;4-[4-(8-methylquinolin-7-yl)phenoxy]piperidine-1-carbaldehyde (PubChem CID 145214187) has the molecular formula C27H33N3O2
and a molecular weight of 431.58 g/mol. Its IUPAC name is 1-methylpyrrolidine;4-[4-(8-methylquinolin-7-yl)phenoxy]piperidine-1-carbaldehyde.
Molecular Properties
| Compound Name | 1-methylpyrrolidine;4-[4-(8-methylquinolin-7-yl)phenoxy]piperidine-1-carbaldehyde |
| PubChem CID | 145214187 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 1-methylpyrrolidine;4-[4-(8-methylquinolin-7-yl)phenoxy]piperidine-1-carbaldehyde |
| SMILES | CN1CCCC1.Cc1c(-c2ccc(OC3CCN(C=O)CC3)cc2)ccc2cccnc12 |
| InChI | InChI=1S/C22H22N2O2.C5H11N/c1-16-21(9-6-18-3-2-12-23-22(16)18)17-4-7-19(8-5-17)26-20-10-13-24(15-25)14-11-20;1-6-4-2-3-5-6/h2-9,12,15,20H,10-11,13-14H2,1H3;2-5H2,1H3 |
| InChIKey | WBSGCODRFOORHL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyrrolidine;4-[4-(8-methylquinolin-7-yl)phenoxy]piperidine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolidine;4-[4-(8-methylquinolin-7-yl)phenoxy]piperidine-1-carbaldehyde?
The IUPAC name of 1-methylpyrrolidine;4-[4-(8-methylquinolin-7-yl)phenoxy]piperidine-1-carbaldehyde (CID 145214187) is 1-methylpyrrolidine;4-[4-(8-methylquinolin-7-yl)phenoxy]piperidine-1-carbaldehyde.
What is the SMILES notation for 1-methylpyrrolidine;4-[4-(8-methylquinolin-7-yl)phenoxy]piperidine-1-carbaldehyde?
The canonical SMILES for 1-methylpyrrolidine;4-[4-(8-methylquinolin-7-yl)phenoxy]piperidine-1-carbaldehyde is CN1CCCC1.Cc1c(-c2ccc(OC3CCN(C=O)CC3)cc2)ccc2cccnc12.
What is the InChIKey of 1-methylpyrrolidine;4-[4-(8-methylquinolin-7-yl)phenoxy]piperidine-1-carbaldehyde?
The InChIKey is WBSGCODRFOORHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O2.C5H11N/c1-16-21(9-6-18-3-2-12-23-22(16)18)17-4-7-19(8-5-17)26-20-10-13-24(15-25)14-11-20;1-6-4-2-3-5-6/h2-9,12,15,20H,10-11,13-14H2,1H3;2-5H2,1H3.
What are the key properties of 1-methylpyrrolidine;4-[4-(8-methylquinolin-7-yl)phenoxy]piperidine-1-carbaldehyde?
1-methylpyrrolidine;4-[4-(8-methylquinolin-7-yl)phenoxy]piperidine-1-carbaldehyde has a molecular weight of 431.58 g/mol, XLogP of 4.92, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolidine;4-[4-(8-methylquinolin-7-yl)phenoxy]piperidine-1-carbaldehyde is sourced from PubChem (CID 145214187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).