C24H28ClN5O2 — CID 145214279
8-chloro-5-[(Z)-1-methoxypent-2-en-2-yl]-N-methyl-3-(4-propan-2-yl-1,3-oxazol-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepin-6-imine (PubChem CID 145214279) has the molecular formula C24H28ClN5O2 and a molecular weight of 453.97 g/mol. Its IUPAC name is 8-chloro-5-[(Z)-1-methoxypent-2-en-2-yl]-N-methyl-3-(4-propan-2-yl-1,3-oxazol-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepin-6-imine.
| Compound Name | 8-chloro-5-[(Z)-1-methoxypent-2-en-2-yl]-N-methyl-3-(4-propan-2-yl-1,3-oxazol-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepin-6-imine |
|---|---|
| PubChem CID | 145214279 |
| Molecular Formula | C24H28ClN5O2 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 8-chloro-5-[(Z)-1-methoxypent-2-en-2-yl]-N-methyl-3-(4-propan-2-yl-1,3-oxazol-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepin-6-imine |
| SMILES | CC/C=C(/COC)N1Cc2c(-c3nc(C(C)C)co3)ncn2-c2ccc(Cl)cc2/C1=N\C |
| InChI | InChI=1S/C24H28ClN5O2/c1-6-7-17(12-31-5)29-11-21-22(24-28-19(13-32-24)15(2)3)27-14-30(21)20-9-8-16(25)10-18(20)23(29)26-4/h7-10,13-15H,6,11-12H2,1-5H3/b17-7-,26-23+ |
| InChIKey | GYHFGCBVTZXKPI-KMYQHHQVSA-N |
| XLogP | 5.44 |
| TPSA | 68.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|