About (9-propylpurin-2-yl)azanide;rubidium(1+)
(9-propylpurin-2-yl)azanide;rubidium(1+) (PubChem CID 145214378) has the molecular formula C8H10N5Rb
and a molecular weight of 261.67 g/mol. Its IUPAC name is (9-propylpurin-2-yl)azanide;rubidium(1+).
Molecular Properties
| Compound Name | (9-propylpurin-2-yl)azanide;rubidium(1+) |
| PubChem CID | 145214378 |
| Molecular Formula | C8H10N5Rb |
| Molecular Weight | 261.67 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | (9-propylpurin-2-yl)azanide;rubidium(1+) |
| SMILES | CCCn1cnc2cnc([NH-])nc21.[Rb+] |
| InChI | InChI=1S/C8H10N5.Rb/c1-2-3-13-5-11-6-4-10-8(9)12-7(6)13;/h4-5H,2-3H2,1H3,(H-,9,10,12);/q-1;+1 |
| InChIKey | DGXVKWJXQQHMPL-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.67 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (9-propylpurin-2-yl)azanide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-propylpurin-2-yl)azanide;rubidium(1+)?
The IUPAC name of (9-propylpurin-2-yl)azanide;rubidium(1+) (CID 145214378) is (9-propylpurin-2-yl)azanide;rubidium(1+).
What is the SMILES notation for (9-propylpurin-2-yl)azanide;rubidium(1+)?
The canonical SMILES for (9-propylpurin-2-yl)azanide;rubidium(1+) is CCCn1cnc2cnc([NH-])nc21.[Rb+].
What is the InChIKey of (9-propylpurin-2-yl)azanide;rubidium(1+)?
The InChIKey is DGXVKWJXQQHMPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N5.Rb/c1-2-3-13-5-11-6-4-10-8(9)12-7(6)13;/h4-5H,2-3H2,1H3,(H-,9,10,12);/q-1;+1.
What are the key properties of (9-propylpurin-2-yl)azanide;rubidium(1+)?
(9-propylpurin-2-yl)azanide;rubidium(1+) has a molecular weight of 261.67 g/mol, XLogP of -1.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9-propylpurin-2-yl)azanide;rubidium(1+) is sourced from PubChem (CID 145214378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).