C17H24F3N3O7 — CID 145216481
tert-butyl (2S)-2-amino-5-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-5-oxopentanoate;2,2,2-trifluoroacetic acid (PubChem CID 145216481) has the molecular formula C17H24F3N3O7 and a molecular weight of 439.39 g/mol. Its IUPAC name is tert-butyl (2S)-2-amino-5-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-5-oxopentanoate;2,2,2-trifluoroacetic acid.
| Compound Name | tert-butyl (2S)-2-amino-5-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-5-oxopentanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 145216481 |
| Molecular Formula | C17H24F3N3O7 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | tert-butyl (2S)-2-amino-5-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-5-oxopentanoate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(C)OC(=O)[C@@H](N)CCC(=O)NCCN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3O5.C2HF3O2/c1-15(2,3)23-14(22)10(16)4-5-11(19)17-8-9-18-12(20)6-7-13(18)21;3-2(4,5)1(6)7/h6-7,10H,4-5,8-9,16H2,1-3H3,(H,17,19);(H,6,7)/t10-;/m0./s1 |
| InChIKey | DREKZZCEFGKEBL-PPHPATTJSA-N |
| XLogP | 0.11 |
| TPSA | 156.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|