C17H15N5O2S2 — CID 145216836
3-amino-6-(2-carbamoylphenyl)sulfanyl-N-(thiophen-2-ylmethyl)pyrazine-2-carboxamide (PubChem CID 145216836) has the molecular formula C17H15N5O2S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 3-amino-6-(2-carbamoylphenyl)sulfanyl-N-(thiophen-2-ylmethyl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-(2-carbamoylphenyl)sulfanyl-N-(thiophen-2-ylmethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 145216836 |
| Molecular Formula | C17H15N5O2S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 3-amino-6-(2-carbamoylphenyl)sulfanyl-N-(thiophen-2-ylmethyl)pyrazine-2-carboxamide |
| SMILES | NC(=O)c1ccccc1Sc1cnc(N)c(C(=O)NCc2cccs2)n1 |
| InChI | InChI=1S/C17H15N5O2S2/c18-15-14(17(24)21-8-10-4-3-7-25-10)22-13(9-20-15)26-12-6-2-1-5-11(12)16(19)23/h1-7,9H,8H2,(H2,18,20)(H2,19,23)(H,21,24) |
| InChIKey | WJUXOANQSBCHQB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |