About 1,4-bis(4-ethylphenyl)benzene;bis(2-methylbuta-1,3-diene)
1,4-bis(4-ethylphenyl)benzene;bis(2-methylbuta-1,3-diene) (PubChem CID 145217101) has the molecular formula C32H38
and a molecular weight of 422.66 g/mol. Its IUPAC name is 1,4-bis(4-ethylphenyl)benzene;bis(2-methylbuta-1,3-diene).
Molecular Properties
| Compound Name | 1,4-bis(4-ethylphenyl)benzene;bis(2-methylbuta-1,3-diene) |
| PubChem CID | 145217101 |
| Molecular Formula | C32H38 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | 1,4-bis(4-ethylphenyl)benzene;bis(2-methylbuta-1,3-diene) |
| SMILES | C=CC(=C)C.C=CC(=C)C.CCc1ccc(-c2ccc(-c3ccc(CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H22.2C5H8/c1-3-17-5-9-19(10-6-17)21-13-15-22(16-14-21)20-11-7-18(4-2)8-12-20;2*1-4-5(2)3/h5-16H,3-4H2,1-2H3;2*4H,1-2H2,3H3 |
| InChIKey | ZUFCVCLNBTZKFV-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(4-ethylphenyl)benzene;bis(2-methylbuta-1,3-diene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(4-ethylphenyl)benzene;bis(2-methylbuta-1,3-diene)?
The IUPAC name of 1,4-bis(4-ethylphenyl)benzene;bis(2-methylbuta-1,3-diene) (CID 145217101) is 1,4-bis(4-ethylphenyl)benzene;bis(2-methylbuta-1,3-diene).
What is the SMILES notation for 1,4-bis(4-ethylphenyl)benzene;bis(2-methylbuta-1,3-diene)?
The canonical SMILES for 1,4-bis(4-ethylphenyl)benzene;bis(2-methylbuta-1,3-diene) is C=CC(=C)C.C=CC(=C)C.CCc1ccc(-c2ccc(-c3ccc(CC)cc3)cc2)cc1.
What is the InChIKey of 1,4-bis(4-ethylphenyl)benzene;bis(2-methylbuta-1,3-diene)?
The InChIKey is ZUFCVCLNBTZKFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22.2C5H8/c1-3-17-5-9-19(10-6-17)21-13-15-22(16-14-21)20-11-7-18(4-2)8-12-20;2*1-4-5(2)3/h5-16H,3-4H2,1-2H3;2*4H,1-2H2,3H3.
What are the key properties of 1,4-bis(4-ethylphenyl)benzene;bis(2-methylbuta-1,3-diene)?
1,4-bis(4-ethylphenyl)benzene;bis(2-methylbuta-1,3-diene) has a molecular weight of 422.66 g/mol, XLogP of 9.64, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(4-ethylphenyl)benzene;bis(2-methylbuta-1,3-diene) is sourced from PubChem (CID 145217101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).